About 6,10-dimethylundeca-5,9-dien-2-imine
6,10-dimethylundeca-5,9-dien-2-imine (PubChem CID 123213234) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 6,10-dimethylundeca-5,9-dien-2-imine.
Molecular Properties
| Compound Name | 6,10-dimethylundeca-5,9-dien-2-imine |
| PubChem CID | 123213234 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 6,10-dimethylundeca-5,9-dien-2-imine |
| SMILES | [H]/N=C(\C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C13H23N/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9,14H,5-6,8,10H2,1-4H3/b12-9?,14-13+ |
| InChIKey | MSDHBISNBIPTLX-SQAHJDJSSA-N |
| XLogP | 4.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,10-dimethylundeca-5,9-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,10-dimethylundeca-5,9-dien-2-imine?
The IUPAC name of 6,10-dimethylundeca-5,9-dien-2-imine (CID 123213234) is 6,10-dimethylundeca-5,9-dien-2-imine.
What is the SMILES notation for 6,10-dimethylundeca-5,9-dien-2-imine?
The canonical SMILES for 6,10-dimethylundeca-5,9-dien-2-imine is [H]/N=C(\C)CCC=C(C)CCC=C(C)C.
What is the InChIKey of 6,10-dimethylundeca-5,9-dien-2-imine?
The InChIKey is MSDHBISNBIPTLX-SQAHJDJSSA-N. The full InChI is InChI=1S/C13H23N/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9,14H,5-6,8,10H2,1-4H3/b12-9?,14-13+.
What are the key properties of 6,10-dimethylundeca-5,9-dien-2-imine?
6,10-dimethylundeca-5,9-dien-2-imine has a molecular weight of 193.33 g/mol, XLogP of 4.50, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,10-dimethylundeca-5,9-dien-2-imine is sourced from PubChem (CID 123213234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).