C13H12O6 — CID 123220505
6-(2,5-dioxooxolan-3-yl)-7-methyl-3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 123220505) has the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. Its IUPAC name is 6-(2,5-dioxooxolan-3-yl)-7-methyl-3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 6-(2,5-dioxooxolan-3-yl)-7-methyl-3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 123220505 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 6-(2,5-dioxooxolan-3-yl)-7-methyl-3a,4,5,6-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC1=C2C(=O)OC(=O)C2CCC1C1CC(=O)OC1=O |
| InChI | InChI=1S/C13H12O6/c1-5-6(8-4-9(14)18-12(8)16)2-3-7-10(5)13(17)19-11(7)15/h6-8H,2-4H2,1H3 |
| InChIKey | BFVGGZNVIMIDCA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|