C20H23NO4 — CID 123220978
3-[[hydroxy-(1-oxo-4a,7-dihydro-4H-naphthalen-2-yl)methyl]-methylamino]-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 123220978) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[[hydroxy-(1-oxo-4a,7-dihydro-4H-naphthalen-2-yl)methyl]-methylamino]-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 3-[[hydroxy-(1-oxo-4a,7-dihydro-4H-naphthalen-2-yl)methyl]-methylamino]-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 123220978 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[[hydroxy-(1-oxo-4a,7-dihydro-4H-naphthalen-2-yl)methyl]-methylamino]-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | CC1C=C(N(C)C(O)C2=CCC3C=CCC=C3C2=O)C=C(C(=O)O)C1 |
| InChI | InChI=1S/C20H23NO4/c1-12-9-14(20(24)25)11-15(10-12)21(2)19(23)17-8-7-13-5-3-4-6-16(13)18(17)22/h3,5-6,8,10-13,19,23H,4,7,9H2,1-2H3,(H,24,25) |
| InChIKey | APAIVXZOUOKJOL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|