C13H24N2+2 — CID 123223807
methyl-[2-[4-methylhex-4-en-3-yl(methylidene)azaniumyl]prop-2-enyl]-methylideneazanium (PubChem CID 123223807) has the molecular formula C13H24N2+2 and a molecular weight of 208.35 g/mol. Its IUPAC name is methyl-[2-[4-methylhex-4-en-3-yl(methylidene)azaniumyl]prop-2-enyl]-methylideneazanium.
| Compound Name | methyl-[2-[4-methylhex-4-en-3-yl(methylidene)azaniumyl]prop-2-enyl]-methylideneazanium |
|---|---|
| PubChem CID | 123223807 |
| Molecular Formula | C13H24N2+2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | methyl-[2-[4-methylhex-4-en-3-yl(methylidene)azaniumyl]prop-2-enyl]-methylideneazanium |
| SMILES | C=C(C[N+](=C)C)[N+](=C)C(CC)C(C)=CC |
| InChI | InChI=1S/C13H24N2/c1-8-11(3)13(9-2)15(7)12(4)10-14(5)6/h8,13H,4-5,7,9-10H2,1-3,6H3/q+2 |
| InChIKey | TWIFLAHOYUFKFM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|