C9H16N2 — CID 142082937
(2Z)-N,N,4-trimethyl-2-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 142082937) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2Z)-N,N,4-trimethyl-2-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-N,N,4-trimethyl-2-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142082937 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2Z)-N,N,4-trimethyl-2-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=N/C(=C\C(=C)C)CN(C)C |
| InChI | InChI=1S/C9H16N2/c1-8(2)6-9(10-3)7-11(4)5/h6H,1,3,7H2,2,4-5H3/b9-6- |
| InChIKey | YTSLGNTUWICFPN-TWGQIWQCSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|