About 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate
1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate (PubChem CID 123227831) has the molecular formula C15H21NO4
and a molecular weight of 279.34 g/mol. Its IUPAC name is 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate.
Molecular Properties
| Compound Name | 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate |
| PubChem CID | 123227831 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate |
| SMILES | CC1OC(=O)C1NC(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H21NO4/c1-8-12(13(17)19-8)16-14(18)20-15-5-9-2-10(6-15)4-11(3-9)7-15/h8-12H,2-7H2,1H3,(H,16,18) |
| InChIKey | COLKEDIOXJPRRE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate?
The IUPAC name of 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate (CID 123227831) is 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate.
What is the SMILES notation for 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate?
The canonical SMILES for 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate is CC1OC(=O)C1NC(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate?
The InChIKey is COLKEDIOXJPRRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-8-12(13(17)19-8)16-14(18)20-15-5-9-2-10(6-15)4-11(3-9)7-15/h8-12H,2-7H2,1H3,(H,16,18).
What are the key properties of 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate?
1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate has a molecular weight of 279.34 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl N-(2-methyl-4-oxooxetan-3-yl)carbamate is sourced from PubChem (CID 123227831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).