C10H17N — CID 123231555
3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-indole (PubChem CID 123231555) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-indole.
| Compound Name | 3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-indole |
|---|---|
| PubChem CID | 123231555 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3,7-dimethyl-3,3a,4,5,6,7-hexahydro-2H-indole |
| SMILES | CC1CCCC2C1=NCC2C |
| InChI | InChI=1S/C10H17N/c1-7-4-3-5-9-8(2)6-11-10(7)9/h7-9H,3-6H2,1-2H3 |
| InChIKey | RLEVPOXFTPPSOP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |