C19H28F3N3O4 — CID 123234785
2-[(2-amino-2-oxoethyl)-[2-(4-pentylphenoxy)ethyl]amino]acetamide;2,2,2-trifluoroacetaldehyde (PubChem CID 123234785) has the molecular formula C19H28F3N3O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[2-(4-pentylphenoxy)ethyl]amino]acetamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[2-(4-pentylphenoxy)ethyl]amino]acetamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 123234785 |
| Molecular Formula | C19H28F3N3O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[2-(4-pentylphenoxy)ethyl]amino]acetamide;2,2,2-trifluoroacetaldehyde |
| SMILES | CCCCCc1ccc(OCCN(CC(N)=O)CC(N)=O)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C17H27N3O3.C2HF3O/c1-2-3-4-5-14-6-8-15(9-7-14)23-11-10-20(12-16(18)21)13-17(19)22;3-2(4,5)1-6/h6-9H,2-5,10-13H2,1H3,(H2,18,21)(H2,19,22);1H |
| InChIKey | DZFILYMPCULMHD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|