C17H16ClN3O — CID 123236132
2-amino-5-chloro-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)indol-3-ol (PubChem CID 123236132) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)indol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)indol-3-ol |
|---|---|
| PubChem CID | 123236132 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-amino-5-chloro-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)indol-3-ol |
| SMILES | NC1=Nc2ccc(Cl)cc2C1(O)c1cccc2c1CNCC2 |
| InChI | InChI=1S/C17H16ClN3O/c18-11-4-5-15-14(8-11)17(22,16(19)21-15)13-3-1-2-10-6-7-20-9-12(10)13/h1-5,8,20,22H,6-7,9H2,(H2,19,21) |
| InChIKey | AIFMXSASLBKUQE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |