C11H24B2O4 — CID 123236906
ethoxy-propan-2-yloxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane (PubChem CID 123236906) has the molecular formula C11H24B2O4 and a molecular weight of 241.93 g/mol. Its IUPAC name is ethoxy-propan-2-yloxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane.
| Compound Name | ethoxy-propan-2-yloxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
|---|---|
| PubChem CID | 123236906 |
| Molecular Formula | C11H24B2O4 |
| Molecular Weight | 241.93 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | ethoxy-propan-2-yloxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
| SMILES | CCOB(OC(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H24B2O4/c1-8-14-12(15-9(2)3)13-16-10(4,5)11(6,7)17-13/h9H,8H2,1-7H3 |
| InChIKey | HCZAFIVMIJMXHK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.93 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|