C6H11NOS — CID 123240033
5-ethyl-3-methyl-4H-1,2-oxazole-5-thiol (PubChem CID 123240033) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is 5-ethyl-3-methyl-4H-1,2-oxazole-5-thiol.
| Compound Name | 5-ethyl-3-methyl-4H-1,2-oxazole-5-thiol |
|---|---|
| PubChem CID | 123240033 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5-ethyl-3-methyl-4H-1,2-oxazole-5-thiol |
| SMILES | CCC1(S)CC(C)=NO1 |
| InChI | InChI=1S/C6H11NOS/c1-3-6(9)4-5(2)7-8-6/h9H,3-4H2,1-2H3 |
| InChIKey | BGRVBNDWSUICAV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 21.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|