C8H15NO2 — CID 40523018
(5R)-5-tert-butyl-3-methyl-4H-1,2-oxazol-5-ol (PubChem CID 40523018) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (5R)-5-tert-butyl-3-methyl-4H-1,2-oxazol-5-ol.
| Compound Name | (5R)-5-tert-butyl-3-methyl-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 40523018 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (5R)-5-tert-butyl-3-methyl-4H-1,2-oxazol-5-ol |
| SMILES | CC1=NO[C@@](O)(C(C)(C)C)C1 |
| InChI | InChI=1S/C8H15NO2/c1-6-5-8(10,11-9-6)7(2,3)4/h10H,5H2,1-4H3/t8-/m1/s1 |
| InChIKey | QSEBUVNPCAHKHF-MRVPVSSYSA-N |
| XLogP | 1.52 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |