C19H21FN2O — CID 123242255
2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-methylidenecyclohexyl)ethanol (PubChem CID 123242255) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-methylidenecyclohexyl)ethanol.
| Compound Name | 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-methylidenecyclohexyl)ethanol |
|---|---|
| PubChem CID | 123242255 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-methylidenecyclohexyl)ethanol |
| SMILES | C=C1CCC(C(CO)c2c3c(c4cncn24)=CC=CC3F)CC1 |
| InChI | InChI=1S/C19H21FN2O/c1-12-5-7-13(8-6-12)15(10-23)19-18-14(3-2-4-16(18)20)17-9-21-11-22(17)19/h2-4,9,11,13,15-16,23H,1,5-8,10H2 |
| InChIKey | CTPWKUIGGSYVCW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|