C21H25FN2O — CID 123251202
2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-propan-2-ylidenecyclohexyl)ethanol (PubChem CID 123251202) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-propan-2-ylidenecyclohexyl)ethanol.
| Compound Name | 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-propan-2-ylidenecyclohexyl)ethanol |
|---|---|
| PubChem CID | 123251202 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)-2-(4-propan-2-ylidenecyclohexyl)ethanol |
| SMILES | CC(C)=C1CCC(C(CO)c2c3c(c4cncn24)=CC=CC3F)CC1 |
| InChI | InChI=1S/C21H25FN2O/c1-13(2)14-6-8-15(9-7-14)17(11-25)21-20-16(4-3-5-18(20)22)19-10-23-12-24(19)21/h3-5,10,12,15,17-18,25H,6-9,11H2,1-2H3 |
| InChIKey | IUTVKHSFUFNKLV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|