C18H20F2N2O — CID 123708692
2-(4,4-difluorocyclohexyl)-2-(6H-imidazo[1,5-b]isoindol-5-yl)ethanol (PubChem CID 123708692) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-2-(6H-imidazo[1,5-b]isoindol-5-yl)ethanol.
| Compound Name | 2-(4,4-difluorocyclohexyl)-2-(6H-imidazo[1,5-b]isoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 123708692 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-2-(6H-imidazo[1,5-b]isoindol-5-yl)ethanol |
| SMILES | OCC(c1c2c(c3cncn13)=CC=CC2)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H20F2N2O/c19-18(20)7-5-12(6-8-18)15(10-23)17-14-4-2-1-3-13(14)16-9-21-11-22(16)17/h1-3,9,11-12,15,23H,4-8,10H2 |
| InChIKey | FUIXSXXOAYFUQB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |