C18H17F3N2O — CID 123168407
2-(4,4-difluorocyclohexyl)-2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)acetaldehyde (PubChem CID 123168407) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)acetaldehyde.
| Compound Name | 2-(4,4-difluorocyclohexyl)-2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)acetaldehyde |
|---|---|
| PubChem CID | 123168407 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-2-(6-fluoro-6H-imidazo[1,5-b]isoindol-5-yl)acetaldehyde |
| SMILES | O=CC(c1c2c(c3cncn13)=CC=CC2F)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H17F3N2O/c19-14-3-1-2-12-15-8-22-10-23(15)17(16(12)14)13(9-24)11-4-6-18(20,21)7-5-11/h1-3,8-11,13-14H,4-7H2 |
| InChIKey | RHWYELZGPXLHST-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|