C14H7BBrN5O2 — CID 123242318
2-[[5-bromo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]boranylideneamino]ethenone (PubChem CID 123242318) has the molecular formula C14H7BBrN5O2 and a molecular weight of 367.96 g/mol. Its IUPAC name is 2-[[5-bromo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]boranylideneamino]ethenone.
| Compound Name | 2-[[5-bromo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]boranylideneamino]ethenone |
|---|---|
| PubChem CID | 123242318 |
| Molecular Formula | C14H7BBrN5O2 |
| Molecular Weight | 367.96 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-[[5-bromo-3-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]boranylideneamino]ethenone |
| SMILES | O=C=C/N=B/c1ncc(Br)nc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C14H7BBrN5O2/c16-10-8-17-12(15-18-6-7-22)11(19-10)14-21-20-13(23-14)9-4-2-1-3-5-9/h1-6,8H |
| InChIKey | NUMUQRODIBCUCE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 94.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.96 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|