C23H26N2O3S — CID 123245289
[1-[9H-fluoren-9-ylmethoxy(hydroxy)methyl]pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone (PubChem CID 123245289) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [1-[9H-fluoren-9-ylmethoxy(hydroxy)methyl]pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone.
| Compound Name | [1-[9H-fluoren-9-ylmethoxy(hydroxy)methyl]pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 123245289 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [1-[9H-fluoren-9-ylmethoxy(hydroxy)methyl]pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
| SMILES | O=C(C1CCCN1C(O)OCC1c2ccccc2-c2ccccc21)N1CCSC1 |
| InChI | InChI=1S/C23H26N2O3S/c26-22(24-12-13-29-15-24)21-10-5-11-25(21)23(27)28-14-20-18-8-3-1-6-16(18)17-7-2-4-9-19(17)20/h1-4,6-9,20-21,23,27H,5,10-15H2 |
| InChIKey | RZMOZUXKMZRLFS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|