C20H23N3O4S — CID 59940867
2-[2-methyl-3-oxo-3-[2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 59940867) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[2-methyl-3-oxo-3-[2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-methyl-3-oxo-3-[2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59940867 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[2-methyl-3-oxo-3-[2-(1,3-thiazolidine-3-carbonyl)pyrrolidin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | CC(CN1C(=O)c2ccccc2C1=O)C(=O)N1CCCC1C(=O)N1CCSC1 |
| InChI | InChI=1S/C20H23N3O4S/c1-13(11-23-18(25)14-5-2-3-6-15(14)19(23)26)17(24)22-8-4-7-16(22)20(27)21-9-10-28-12-21/h2-3,5-6,13,16H,4,7-12H2,1H3 |
| InChIKey | UKNDGSRNOJDPPT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|