C33H49N3O7 — CID 14723811
tert-butyl (2S)-1-[(2S)-2-[[(2S)-11-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoundecan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 14723811) has the molecular formula C33H49N3O7 and a molecular weight of 599.77 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2S)-2-[[(2S)-11-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoundecan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2S)-2-[[(2S)-11-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoundecan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 14723811 |
| Molecular Formula | C33H49N3O7 |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.36 |
| IUPAC Name | tert-butyl (2S)-1-[(2S)-2-[[(2S)-11-(1,3-dioxoisoindol-2-yl)-1-ethoxy-1-oxoundecan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H](CCCCCCCCCN1C(=O)c2ccccc2C1=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H49N3O7/c1-6-42-31(40)26(34-23(2)28(37)35-22-16-20-27(35)32(41)43-33(3,4)5)19-12-10-8-7-9-11-15-21-36-29(38)24-17-13-14-18-25(24)30(36)39/h13-14,17-18,23,26-27,34H,6-12,15-16,19-22H2,1-5H3/t23-,26-,27-/m0/s1 |
| InChIKey | LORJBOPJJWBDFB-YGPDHOBYSA-N |
| XLogP | 4.65 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|