C10H25NO2Si — CID 123245425
2-dipropoxysilyl-N,N-dimethylethanamine (PubChem CID 123245425) has the molecular formula C10H25NO2Si and a molecular weight of 219.40 g/mol. Its IUPAC name is 2-dipropoxysilyl-N,N-dimethylethanamine.
| Compound Name | 2-dipropoxysilyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 123245425 |
| Molecular Formula | C10H25NO2Si |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-dipropoxysilyl-N,N-dimethylethanamine |
| SMILES | CCCO[SiH](CCN(C)C)OCCC |
| InChI | InChI=1S/C10H25NO2Si/c1-5-8-12-14(13-9-6-2)10-7-11(3)4/h14H,5-10H2,1-4H3 |
| InChIKey | FZRCZIDLVNXCPB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|