C19H30 — CID 123248552
3,4-dimethylidene-1-(4-methylpent-4-enyl)cycloundecene (PubChem CID 123248552) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 3,4-dimethylidene-1-(4-methylpent-4-enyl)cycloundecene.
| Compound Name | 3,4-dimethylidene-1-(4-methylpent-4-enyl)cycloundecene |
|---|---|
| PubChem CID | 123248552 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 3,4-dimethylidene-1-(4-methylpent-4-enyl)cycloundecene |
| SMILES | C=C(C)CCCC1=CC(=C)C(=C)CCCCCCC1 |
| InChI | InChI=1S/C19H30/c1-16(2)11-10-14-19-13-9-7-5-6-8-12-17(3)18(4)15-19/h15H,1,3-14H2,2H3 |
| InChIKey | RRXJPYFQGINYDQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|