About (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine
(3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine (PubChem CID 155485176) has the molecular formula C17H27N
and a molecular weight of 245.41 g/mol. Its IUPAC name is (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine.
Molecular Properties
| Compound Name | (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine |
| PubChem CID | 155485176 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine |
| SMILES | C=C(C)CCCC/C(C)=C/C=C1/CCCNC1=C |
| InChI | InChI=1S/C17H27N/c1-14(2)8-5-6-9-15(3)11-12-17-10-7-13-18-16(17)4/h11-12,18H,1,4-10,13H2,2-3H3/b15-11+,17-12- |
| InChIKey | YECDYTFAYHIEPS-GLDUUKHASA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine?
The IUPAC name of (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine (CID 155485176) is (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine.
What is the SMILES notation for (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine?
The canonical SMILES for (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine is C=C(C)CCCC/C(C)=C/C=C1/CCCNC1=C.
What is the InChIKey of (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine?
The InChIKey is YECDYTFAYHIEPS-GLDUUKHASA-N. The full InChI is InChI=1S/C17H27N/c1-14(2)8-5-6-9-15(3)11-12-17-10-7-13-18-16(17)4/h11-12,18H,1,4-10,13H2,2-3H3/b15-11+,17-12-.
What are the key properties of (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine?
(3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine has a molecular weight of 245.41 g/mol, XLogP of 4.89, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2E)-3,8-dimethylnona-2,8-dienylidene]-2-methylidenepiperidine is sourced from PubChem (CID 155485176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).