C24H40N2O3 — CID 163625846
(E,12Z)-2-acetamido-12-[(2E)-2-butan-2-ylidenepiperidin-3-ylidene]-10-methyldodec-10-enoic acid (PubChem CID 163625846) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is (E,12Z)-2-acetamido-12-[(2E)-2-butan-2-ylidenepiperidin-3-ylidene]-10-methyldodec-10-enoic acid.
| Compound Name | (E,12Z)-2-acetamido-12-[(2E)-2-butan-2-ylidenepiperidin-3-ylidene]-10-methyldodec-10-enoic acid |
|---|---|
| PubChem CID | 163625846 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | (E,12Z)-2-acetamido-12-[(2E)-2-butan-2-ylidenepiperidin-3-ylidene]-10-methyldodec-10-enoic acid |
| SMILES | CC/C(C)=C1/NCCC/C1=C/C=C(\C)CCCCCCCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C24H40N2O3/c1-5-19(3)23-21(13-11-17-25-23)16-15-18(2)12-9-7-6-8-10-14-22(24(28)29)26-20(4)27/h15-16,22,25H,5-14,17H2,1-4H3,(H,26,27)(H,28,29)/b18-15+,21-16-,23-19+ |
| InChIKey | HRYAMWBEKXSYAT-VCDRNTSHSA-N |
| XLogP | 5.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|