C10H15NO3 — CID 10535923
2-acetamidoocta-6,7-dienoic acid (PubChem CID 10535923) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-acetamidoocta-6,7-dienoic acid.
| Compound Name | 2-acetamidoocta-6,7-dienoic acid |
|---|---|
| PubChem CID | 10535923 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-acetamidoocta-6,7-dienoic acid |
| SMILES | C=C=CCCCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-3-4-5-6-7-9(10(13)14)11-8(2)12/h4,9H,1,5-7H2,2H3,(H,11,12)(H,13,14) |
| InChIKey | GCRYELMGIODAFI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|