C13H14N2O5S — CID 123251260
2-diazo-2-[4-(oxan-4-ylsulfonyl)phenyl]acetic acid (PubChem CID 123251260) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-diazo-2-[4-(oxan-4-ylsulfonyl)phenyl]acetic acid.
| Compound Name | 2-diazo-2-[4-(oxan-4-ylsulfonyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 123251260 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-diazo-2-[4-(oxan-4-ylsulfonyl)phenyl]acetic acid |
| SMILES | [N-]=[N+]=C(C(=O)O)c1ccc(S(=O)(=O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C13H14N2O5S/c14-15-12(13(16)17)9-1-3-10(4-2-9)21(18,19)11-5-7-20-8-6-11/h1-4,11H,5-8H2,(H,16,17) |
| InChIKey | HUSOOZZTAFOIQL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|