C16H21NO4S — CID 68898050
3-(dimethylamino)-1-[4-(oxan-4-ylsulfonyl)phenyl]prop-2-en-1-one (PubChem CID 68898050) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[4-(oxan-4-ylsulfonyl)phenyl]prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1-[4-(oxan-4-ylsulfonyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68898050 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(dimethylamino)-1-[4-(oxan-4-ylsulfonyl)phenyl]prop-2-en-1-one |
| SMILES | CN(C)C=CC(=O)c1ccc(S(=O)(=O)C2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21NO4S/c1-17(2)10-7-16(18)13-3-5-14(6-4-13)22(19,20)15-8-11-21-12-9-15/h3-7,10,15H,8-9,11-12H2,1-2H3 |
| InChIKey | MFSRQLLZODSCHX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|