C18H21N5OS — CID 123252767
[(1-pyridin-3-ylazetidin-3-yl)amino]-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol (PubChem CID 123252767) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is [(1-pyridin-3-ylazetidin-3-yl)amino]-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol.
| Compound Name | [(1-pyridin-3-ylazetidin-3-yl)amino]-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol |
|---|---|
| PubChem CID | 123252767 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [(1-pyridin-3-ylazetidin-3-yl)amino]-(3,4,5-trimethylthieno[2,3-c]pyridazin-6-yl)methanol |
| SMILES | Cc1nnc2sc(C(O)NC3CN(c4cccnc4)C3)c(C)c2c1C |
| InChI | InChI=1S/C18H21N5OS/c1-10-12(3)21-22-18-15(10)11(2)16(25-18)17(24)20-13-8-23(9-13)14-5-4-6-19-7-14/h4-7,13,17,20,24H,8-9H2,1-3H3 |
| InChIKey | WCNRAUSTUMRINZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|