C19H22N4OS — CID 123289038
(3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(1-phenylpyrrolidin-3-yl)amino]methanol (PubChem CID 123289038) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is (3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(1-phenylpyrrolidin-3-yl)amino]methanol.
| Compound Name | (3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(1-phenylpyrrolidin-3-yl)amino]methanol |
|---|---|
| PubChem CID | 123289038 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(1-phenylpyrrolidin-3-yl)amino]methanol |
| SMILES | Cc1nnc2sc(C(O)NC3CCN(c4ccccc4)C3)cc2c1C |
| InChI | InChI=1S/C19H22N4OS/c1-12-13(2)21-22-19-16(12)10-17(25-19)18(24)20-14-8-9-23(11-14)15-6-4-3-5-7-15/h3-7,10,14,18,20,24H,8-9,11H2,1-2H3 |
| InChIKey | AZGBMOFLGGFJIW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|