C19H22FN5OS — CID 126496522
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]methanol (PubChem CID 126496522) has the molecular formula C19H22FN5OS and a molecular weight of 387.48 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]methanol |
|---|---|
| PubChem CID | 126496522 |
| Molecular Formula | C19H22FN5OS |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-fluorophenyl)pyrrolidin-3-yl]amino]methanol |
| SMILES | Cc1nnc2sc(C(O)NC3CCN(c4ccc(F)cc4)C3)c(N)c2c1C |
| InChI | InChI=1S/C19H22FN5OS/c1-10-11(2)23-24-19-15(10)16(21)17(27-19)18(26)22-13-7-8-25(9-13)14-5-3-12(20)4-6-14/h3-6,13,18,22,26H,7-9,21H2,1-2H3 |
| InChIKey | CRIWTYLOESEMNO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|