C21H19F2N5OS — CID 126496348
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2,6-difluoro-3-pyridinyl)phenyl]methylamino]methanol (PubChem CID 126496348) has the molecular formula C21H19F2N5OS and a molecular weight of 427.48 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2,6-difluoro-3-pyridinyl)phenyl]methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2,6-difluoro-3-pyridinyl)phenyl]methylamino]methanol |
|---|---|
| PubChem CID | 126496348 |
| Molecular Formula | C21H19F2N5OS |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[4-(2,6-difluoro-3-pyridinyl)phenyl]methylamino]methanol |
| SMILES | Cc1nnc2sc(C(O)NCc3ccc(-c4ccc(F)nc4F)cc3)c(N)c2c1C |
| InChI | InChI=1S/C21H19F2N5OS/c1-10-11(2)27-28-21-16(10)17(24)18(30-21)20(29)25-9-12-3-5-13(6-4-12)14-7-8-15(22)26-19(14)23/h3-8,20,25,29H,9,24H2,1-2H3 |
| InChIKey | RQYFKKPSCSHCJB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|