C20H25N5O3S2 — CID 126496367
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]methanol (PubChem CID 126496367) has the molecular formula C20H25N5O3S2 and a molecular weight of 447.59 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]methanol |
|---|---|
| PubChem CID | 126496367 |
| Molecular Formula | C20H25N5O3S2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]amino]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(O)c3sc4nnc(C)c(C)c4c3N)C2)cc1 |
| InChI | InChI=1S/C20H25N5O3S2/c1-11-4-6-15(7-5-11)30(27,28)25-9-8-14(10-25)22-19(26)18-17(21)16-12(2)13(3)23-24-20(16)29-18/h4-7,14,19,22,26H,8-10,21H2,1-3H3 |
| InChIKey | RIPZLATZSURXTB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|