C22H20N2O5S — CID 123266149
4-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-(3-methoxyphenyl)benzenesulfonamide (PubChem CID 123266149) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-(3-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-(3-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 123266149 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-N-(3-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(NS(=O)(=O)c2ccc(-n3c(O)c4c(c3O)[C@H]3C=CC4C3)cc2)c1 |
| InChI | InChI=1S/C22H20N2O5S/c1-29-17-4-2-3-15(12-17)23-30(27,28)18-9-7-16(8-10-18)24-21(25)19-13-5-6-14(11-13)20(19)22(24)26/h2-10,12-14,23,25-26H,11H2,1H3/t13-,14?/m0/s1 |
| InChIKey | NYIBPZHMYQBJHU-LSLKUGRBSA-N |
| XLogP | 3.84 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|