C16H37N3O3Si3 — CID 123266948
2-N,4-N,6-N-tris(trimethylsilyloxy)hepta-1,3,5-triene-2,4,6-triamine (PubChem CID 123266948) has the molecular formula C16H37N3O3Si3 and a molecular weight of 403.75 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris(trimethylsilyloxy)hepta-1,3,5-triene-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris(trimethylsilyloxy)hepta-1,3,5-triene-2,4,6-triamine |
|---|---|
| PubChem CID | 123266948 |
| Molecular Formula | C16H37N3O3Si3 |
| Molecular Weight | 403.75 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-N,4-N,6-N-tris(trimethylsilyloxy)hepta-1,3,5-triene-2,4,6-triamine |
| SMILES | C=C(C=C(C=C(C)NO[Si](C)(C)C)NO[Si](C)(C)C)NO[Si](C)(C)C |
| InChI | InChI=1S/C16H37N3O3Si3/c1-14(17-20-23(3,4)5)12-16(19-22-25(9,10)11)13-15(2)18-21-24(6,7)8/h12-13,17-19H,1H2,2-11H3 |
| InChIKey | YETPQNMHMQLFGE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|