C23H42N2O2 — CID 123267406
3-N-ethyl-7-methoxy-1-N-(5-methoxy-3-methylidenehex-4-enyl)-5-methyl-4-propan-2-ylocta-5,7-diene-1,3-diamine (PubChem CID 123267406) has the molecular formula C23H42N2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 3-N-ethyl-7-methoxy-1-N-(5-methoxy-3-methylidenehex-4-enyl)-5-methyl-4-propan-2-ylocta-5,7-diene-1,3-diamine.
| Compound Name | 3-N-ethyl-7-methoxy-1-N-(5-methoxy-3-methylidenehex-4-enyl)-5-methyl-4-propan-2-ylocta-5,7-diene-1,3-diamine |
|---|---|
| PubChem CID | 123267406 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 3-N-ethyl-7-methoxy-1-N-(5-methoxy-3-methylidenehex-4-enyl)-5-methyl-4-propan-2-ylocta-5,7-diene-1,3-diamine |
| SMILES | C=C(C=C(C)OC)CCNCCC(NCC)C(C(C)=CC(=C)OC)C(C)C |
| InChI | InChI=1S/C23H42N2O2/c1-10-25-22(23(17(2)3)19(5)16-21(7)27-9)12-14-24-13-11-18(4)15-20(6)26-8/h15-17,22-25H,4,7,10-14H2,1-3,5-6,8-9H3 |
| InChIKey | KKGHPXAFRZMQSE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|