C27H26N2O4S — CID 123268296
[4-(3-phenylpentan-3-yl)phenyl] 6-diazo-4-hydroxy-5H-naphthalene-1-sulfonate (PubChem CID 123268296) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is [4-(3-phenylpentan-3-yl)phenyl] 6-diazo-4-hydroxy-5H-naphthalene-1-sulfonate.
| Compound Name | [4-(3-phenylpentan-3-yl)phenyl] 6-diazo-4-hydroxy-5H-naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 123268296 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [4-(3-phenylpentan-3-yl)phenyl] 6-diazo-4-hydroxy-5H-naphthalene-1-sulfonate |
| SMILES | CCC(CC)(c1ccccc1)c1ccc(OS(=O)(=O)c2ccc(O)c3c2C=CC(=[N+]=[N-])C3)cc1 |
| InChI | InChI=1S/C27H26N2O4S/c1-3-27(4-2,19-8-6-5-7-9-19)20-10-13-22(14-11-20)33-34(31,32)26-17-16-25(30)24-18-21(29-28)12-15-23(24)26/h5-17,30H,3-4,18H2,1-2H3 |
| InChIKey | SLEHZDYWOUJDPK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|