C36H28N2O8S2 — CID 145481831
[4-[2-[4-(6-imino-5-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl] 6-imino-5-oxonaphthalene-1-sulfonate (PubChem CID 145481831) has the molecular formula C36H28N2O8S2 and a molecular weight of 680.76 g/mol. Its IUPAC name is [4-[2-[4-(6-imino-5-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl] 6-imino-5-oxonaphthalene-1-sulfonate.
| Compound Name | [4-[2-[4-(6-imino-5-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl] 6-imino-5-oxonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 145481831 |
| Molecular Formula | C36H28N2O8S2 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | [4-[2-[4-(6-imino-5-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl] 6-imino-5-oxonaphthalene-1-sulfonate |
| SMILES | [H]/N=C1\C=Cc2c(cccc2S(=O)(=O)Oc2ccc(C(C)(CC)c3ccc(OS(=O)(=O)c4cccc5c4C=C/C(=N\[H])C5=O)cc3)cc2)C1=O |
| InChI | InChI=1S/C36H28N2O8S2/c1-3-36(2,22-10-14-24(15-11-22)45-47(41,42)32-8-4-6-28-26(32)18-20-30(37)34(28)39)23-12-16-25(17-13-23)46-48(43,44)33-9-5-7-29-27(33)19-21-31(38)35(29)40/h4-21,37-38H,3H2,1-2H3/b37-30+,38-31+ |
| InChIKey | XQJBGWPVBPGRMC-VATSPAEJSA-N |
| XLogP | 6.40 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|