C36H26N4O8S2 — CID 87522139
3-diazonio-2-[4-[2-[4-(3-iminoazaniumylidene-4-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl]-4-oxidonaphthalene-1-sulfonate (PubChem CID 87522139) has the molecular formula C36H26N4O8S2 and a molecular weight of 706.76 g/mol. Its IUPAC name is 3-diazonio-2-[4-[2-[4-(3-iminoazaniumylidene-4-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl]-4-oxidonaphthalene-1-sulfonate.
| Compound Name | 3-diazonio-2-[4-[2-[4-(3-iminoazaniumylidene-4-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl]-4-oxidonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 87522139 |
| Molecular Formula | C36H26N4O8S2 |
| Molecular Weight | 706.76 g/mol |
| Exact Mass | 706.12 |
| IUPAC Name | 3-diazonio-2-[4-[2-[4-(3-iminoazaniumylidene-4-oxonaphthalen-1-yl)sulfonyloxyphenyl]butan-2-yl]phenyl]-4-oxidonaphthalene-1-sulfonate |
| SMILES | CCC(C)(c1ccc(OS(=O)(=O)C2=CC(=[N+]=N)C(=O)c3ccccc32)cc1)c1ccc(-c2c([N+]#N)c([O-])c3ccccc3c2S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C36H26N4O8S2/c1-3-36(2,22-14-12-21(13-15-22)31-32(40-38)34(42)27-10-6-7-11-28(27)35(31)49(43,44)45)23-16-18-24(19-17-23)48-50(46,47)30-20-29(39-37)33(41)26-9-5-4-8-25(26)30/h4-20,37H,3H2,1-2H3 |
| InChIKey | WSOXFZZBZXSDCQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 206.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.76 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|