C25H23N6O5PS — CID 123268779
[[5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]-2,3-dihydropyridin-3-yl]sulfonylamino]phosphonic acid (PubChem CID 123268779) has the molecular formula C25H23N6O5PS and a molecular weight of 550.54 g/mol. Its IUPAC name is [[5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]-2,3-dihydropyridin-3-yl]sulfonylamino]phosphonic acid.
| Compound Name | [[5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]-2,3-dihydropyridin-3-yl]sulfonylamino]phosphonic acid |
|---|---|
| PubChem CID | 123268779 |
| Molecular Formula | C25H23N6O5PS |
| Molecular Weight | 550.54 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [[5-[5-phenyl-4-(pyridin-2-ylmethylamino)quinazolin-2-yl]-2,3-dihydropyridin-3-yl]sulfonylamino]phosphonic acid |
| SMILES | O=P(O)(O)NS(=O)(=O)C1C=C(c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3n2)C=NC1 |
| InChI | InChI=1S/C25H23N6O5PS/c32-37(33,34)31-38(35,36)20-13-18(14-26-16-20)24-29-22-11-6-10-21(17-7-2-1-3-8-17)23(22)25(30-24)28-15-19-9-4-5-12-27-19/h1-14,20H,15-16H2,(H,28,29,30)(H3,31,32,33,34) |
| InChIKey | WGMLPTLJYSDVLG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 166.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|