C8H9NO3 — CID 123271123
5-(3-methoxyoxiran-2-yl)-1H-pyridin-2-one (PubChem CID 123271123) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 5-(3-methoxyoxiran-2-yl)-1H-pyridin-2-one.
| Compound Name | 5-(3-methoxyoxiran-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123271123 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 5-(3-methoxyoxiran-2-yl)-1H-pyridin-2-one |
| SMILES | COC1OC1c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H9NO3/c1-11-8-7(12-8)5-2-3-6(10)9-4-5/h2-4,7-8H,1H3,(H,9,10) |
| InChIKey | XOUPVVNLSUSOQG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|