C11H16NO12P3 — CID 129263646
5-[(2S,5R)-5-[(2,6-dihydroxy-2,4,6-trioxo-1,3,2λ5,4λ5,6λ5-dioxatriphosphinan-4-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyridin-2-one (PubChem CID 129263646) has the molecular formula C11H16NO12P3 and a molecular weight of 447.17 g/mol. Its IUPAC name is 5-[(2S,5R)-5-[(2,6-dihydroxy-2,4,6-trioxo-1,3,2λ5,4λ5,6λ5-dioxatriphosphinan-4-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyridin-2-one.
| Compound Name | 5-[(2S,5R)-5-[(2,6-dihydroxy-2,4,6-trioxo-1,3,2λ5,4λ5,6λ5-dioxatriphosphinan-4-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 129263646 |
| Molecular Formula | C11H16NO12P3 |
| Molecular Weight | 447.17 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 5-[(2S,5R)-5-[(2,6-dihydroxy-2,4,6-trioxo-1,3,2λ5,4λ5,6λ5-dioxatriphosphinan-4-yl)oxymethyl]-3,4-dihydroxyoxolan-2-yl]-1H-pyridin-2-one |
| SMILES | O=c1ccc([C@@H]2O[C@H](COP3(=O)CP(=O)(O)OP(=O)(O)O3)C(O)C2O)c[nH]1 |
| InChI | InChI=1S/C11H16NO12P3/c13-8-2-1-6(3-12-8)11-10(15)9(14)7(22-11)4-21-26(18)5-25(16,17)23-27(19,20)24-26/h1-3,7,9-11,14-15H,4-5H2,(H,12,13)(H,16,17)(H,19,20)/t7-,9?,10?,11+,26?/m1/s1 |
| InChIKey | IJGLWFPQYBYQPO-BGIVRSCFSA-N |
| XLogP | 0.04 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.17 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|