C12H23N — CID 123274306
N-butan-2-yl-2,3-dimethylhex-2-en-1-imine (PubChem CID 123274306) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-butan-2-yl-2,3-dimethylhex-2-en-1-imine.
| Compound Name | N-butan-2-yl-2,3-dimethylhex-2-en-1-imine |
|---|---|
| PubChem CID | 123274306 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-butan-2-yl-2,3-dimethylhex-2-en-1-imine |
| SMILES | CCCC(C)=C(C)/C=N/C(C)CC |
| InChI | InChI=1S/C12H23N/c1-6-8-10(3)11(4)9-13-12(5)7-2/h9,12H,6-8H2,1-5H3/b11-10?,13-9+ |
| InChIKey | KARQZCORTJZPOI-QRWATNNNSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|