C9H17N — CID 91465477
(Z)-N,2-dimethylhept-2-en-1-imine (PubChem CID 91465477) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (Z)-N,2-dimethylhept-2-en-1-imine.
| Compound Name | (Z)-N,2-dimethylhept-2-en-1-imine |
|---|---|
| PubChem CID | 91465477 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (Z)-N,2-dimethylhept-2-en-1-imine |
| SMILES | CCCC/C=C(C)\C=N\C |
| InChI | InChI=1S/C9H17N/c1-4-5-6-7-9(2)8-10-3/h7-8H,4-6H2,1-3H3/b9-7-,10-8+ |
| InChIKey | NNXLDBKLWHJJOP-FKJILZIQSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|