C8H14FN — CID 129299980
(Z)-2-fluoro-N,4-dimethylhex-4-en-1-imine (PubChem CID 129299980) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (Z)-2-fluoro-N,4-dimethylhex-4-en-1-imine.
| Compound Name | (Z)-2-fluoro-N,4-dimethylhex-4-en-1-imine |
|---|---|
| PubChem CID | 129299980 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (Z)-2-fluoro-N,4-dimethylhex-4-en-1-imine |
| SMILES | C/C=C(/C)CC(F)/C=N/C |
| InChI | InChI=1S/C8H14FN/c1-4-7(2)5-8(9)6-10-3/h4,6,8H,5H2,1-3H3/b7-4-,10-6+ |
| InChIKey | SSKSHNOOSHDQBV-HLWKLQMVSA-N |
| XLogP | 2.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|