C30H25ClN2 — CID 123275612
1-[(2S)-1-chloro-3-phenylpropan-2-yl]-2,4,5-triphenylimidazole (PubChem CID 123275612) has the molecular formula C30H25ClN2 and a molecular weight of 449.00 g/mol. Its IUPAC name is 1-[(2S)-1-chloro-3-phenylpropan-2-yl]-2,4,5-triphenylimidazole.
| Compound Name | 1-[(2S)-1-chloro-3-phenylpropan-2-yl]-2,4,5-triphenylimidazole |
|---|---|
| PubChem CID | 123275612 |
| Molecular Formula | C30H25ClN2 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 1-[(2S)-1-chloro-3-phenylpropan-2-yl]-2,4,5-triphenylimidazole |
| SMILES | ClC[C@H](Cc1ccccc1)n1c(-c2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H25ClN2/c31-22-27(21-23-13-5-1-6-14-23)33-29(25-17-9-3-10-18-25)28(24-15-7-2-8-16-24)32-30(33)26-19-11-4-12-20-26/h1-20,27H,21-22H2/t27-/m0/s1 |
| InChIKey | CMYGITGJZRUEFF-MHZLTWQESA-N |
| XLogP | 7.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|