C11H26O2Si — CID 123280532
5-(2,3-dimethylbutan-2-ylsilyloxy)pentan-1-ol (PubChem CID 123280532) has the molecular formula C11H26O2Si and a molecular weight of 218.41 g/mol. Its IUPAC name is 5-(2,3-dimethylbutan-2-ylsilyloxy)pentan-1-ol.
| Compound Name | 5-(2,3-dimethylbutan-2-ylsilyloxy)pentan-1-ol |
|---|---|
| PubChem CID | 123280532 |
| Molecular Formula | C11H26O2Si |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 5-(2,3-dimethylbutan-2-ylsilyloxy)pentan-1-ol |
| SMILES | CC(C)C(C)(C)[SiH2]OCCCCCO |
| InChI | InChI=1S/C11H26O2Si/c1-10(2)11(3,4)14-13-9-7-5-6-8-12/h10,12H,5-9,14H2,1-4H3 |
| InChIKey | NZJXLSZHHYITQD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|