C10H25LiOSi — CID 174817482
lithium;butoxy(2,3-dimethylbutan-2-yl)silane;hydride (PubChem CID 174817482) has the molecular formula C10H25LiOSi and a molecular weight of 196.34 g/mol. Its IUPAC name is lithium;butoxy(2,3-dimethylbutan-2-yl)silane;hydride.
| Compound Name | lithium;butoxy(2,3-dimethylbutan-2-yl)silane;hydride |
|---|---|
| PubChem CID | 174817482 |
| Molecular Formula | C10H25LiOSi |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | lithium;butoxy(2,3-dimethylbutan-2-yl)silane;hydride |
| SMILES | CCCCO[SiH2]C(C)(C)C(C)C.[H-].[Li+] |
| InChI | InChI=1S/C10H24OSi.Li.H/c1-6-7-8-11-12-10(4,5)9(2)3;;/h9H,6-8,12H2,1-5H3;;/q;+1;-1 |
| InChIKey | SSTHYUYTFWQKHP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|