C29H50N8O10S — CID 123282584
2-[4-[2-[2-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 123282584) has the molecular formula C29H50N8O10S and a molecular weight of 702.83 g/mol. Its IUPAC name is 2-[4-[2-[2-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 123282584 |
| Molecular Formula | C29H50N8O10S |
| Molecular Weight | 702.83 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | 2-[4-[2-[2-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dihydroxypyrrol-1-yl]ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | NCCCCCNC(=O)CSc1cc(O)n(CCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1O |
| InChI | InChI=1S/C29H50N8O10S/c30-4-2-1-3-5-31-24(39)21-48-22-16-25(40)37(29(22)47)7-6-32-23(38)17-33-8-10-34(18-26(41)42)12-14-36(20-28(45)46)15-13-35(11-9-33)19-27(43)44/h16,40,47H,1-15,17-21,30H2,(H,31,39)(H,32,38)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | MTJRFFYVHLWEEK-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 254.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.83 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|