About 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline
2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline (PubChem CID 123285383) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline.
Molecular Properties
| Compound Name | 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline |
| PubChem CID | 123285383 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline |
| SMILES | c1cncc(Cc2ncc3c(n2)-c2ccccc2CC3)c1 |
| InChI | InChI=1S/C18H15N3/c1-2-6-16-14(5-1)7-8-15-12-20-17(21-18(15)16)10-13-4-3-9-19-11-13/h1-6,9,11-12H,7-8,10H2 |
| InChIKey | MRWQNOPDDBYPQK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline?
The IUPAC name of 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline (CID 123285383) is 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline.
What is the SMILES notation for 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline?
The canonical SMILES for 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline is c1cncc(Cc2ncc3c(n2)-c2ccccc2CC3)c1.
What is the InChIKey of 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline?
The InChIKey is MRWQNOPDDBYPQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c1-2-6-16-14(5-1)7-8-15-12-20-17(21-18(15)16)10-13-4-3-9-19-11-13/h1-6,9,11-12H,7-8,10H2.
What are the key properties of 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline?
2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline has a molecular weight of 273.34 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridin-3-ylmethyl)-5,6-dihydrobenzo[h]quinazoline is sourced from PubChem (CID 123285383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).