C10H16F2N4O4 — CID 123286621
N-(1-amino-3-hydroxypropan-2-yl)oxy-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 123286621) has the molecular formula C10H16F2N4O4 and a molecular weight of 294.26 g/mol. Its IUPAC name is N-(1-amino-3-hydroxypropan-2-yl)oxy-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | N-(1-amino-3-hydroxypropan-2-yl)oxy-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 123286621 |
| Molecular Formula | C10H16F2N4O4 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-(1-amino-3-hydroxypropan-2-yl)oxy-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | NCC(CO)ONC(=O)C1CC(F)(F)C2CN1C(=O)N2 |
| InChI | InChI=1S/C10H16F2N4O4/c11-10(12)1-6(16-3-7(10)14-9(16)19)8(18)15-20-5(2-13)4-17/h5-7,17H,1-4,13H2,(H,14,19)(H,15,18) |
| InChIKey | SLZRZNQVLQDLDW-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|